CymitQuimica logo

CAS 862730-04-9

:

1H-Pyrazolo[3,4-d]pyrimidin-4-amine, 3-iodo-1-(1-methylethyl)-

Description:
1H-Pyrazolo[3,4-d]pyrimidin-4-amine, 3-iodo-1-(1-methylethyl)-, identified by CAS number 862730-04-9, is a heterocyclic compound featuring a pyrazolo-pyrimidine core structure. This compound is characterized by the presence of an amino group at the 4-position and an iodine atom at the 3-position, along with an isopropyl group at the 1-position. Its molecular structure contributes to its potential biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The compound may exhibit properties such as solubility in organic solvents, and its reactivity can be influenced by the functional groups present. Additionally, the iodine substituent can enhance its lipophilicity and may play a role in biological interactions. As with many heterocycles, it may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, which are relevant in synthetic organic chemistry. Overall, this compound's unique structure and substituents suggest potential applications in drug discovery and development.
Formula:C8H10IN5
InChI:InChI=1S/C8H10IN5/c1-4(2)14-8-5(6(9)13-14)7(10)11-3-12-8/h3-4H,1-2H3,(H2,10,11,12)
InChI key:OZULUFUHMFFLQF-UHFFFAOYSA-N
SMILES:CC(C)N1C2=NC=NC(=C2C(=N1)I)N
Found 4 products.