CAS 862730-26-5

2-Amino-6-chloro-4-methylphenol

Description:

2-Amino-6-chloro-4-methylphenol, with the CAS number 862730-26-5, is an organic compound characterized by the presence of an amino group (-NH2), a chloro substituent, and a methyl group on a phenolic ring. This compound typically appears as a solid and is soluble in polar solvents due to the presence of the amino group, which can engage in hydrogen bonding. The chloro substituent introduces a degree of electrophilicity, influencing its reactivity and potential applications in organic synthesis. The methyl group contributes to the compound's hydrophobic character, affecting its solubility and interaction with other molecules. This compound may be utilized in various chemical applications, including as an intermediate in the synthesis of dyes, pharmaceuticals, or agrochemicals. Its properties, such as melting point, boiling point, and specific reactivity, can vary based on the conditions and the presence of other functional groups in a reaction. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₇H₈ClNO

InChI: InChI=1S/C7H8ClNO/c1-4-2-5(8)7(10)6(9)3-4/h2-3,10H,9H2,1H3

InChI key: InChIKey=BXZDSKCPOYLYSK-UHFFFAOYSA-N

SMILES: OC1=C(Cl)C=C(C)C=C1N

Synonyms:

• Phenol, 2-amino-6-chloro-4-methyl-
• 2-Amino-6-chloro-4-methylphenol