CAS 862782-47-6

8-Chloro-2-(2,5-dimethoxyphenyl)-4-quinolinecarboxylic acid

Description:

8-Chloro-2-(2,5-dimethoxyphenyl)-4-quinolinecarboxylic acid is a chemical compound characterized by its complex structure, which includes a quinoline core substituted with a chloro group and a dimethoxyphenyl moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential biological activity due to its structural features. The presence of the chloro group may enhance its reactivity and influence its interaction with biological targets. The dimethoxyphenyl group contributes to its lipophilicity, potentially affecting its solubility and permeability in biological systems. As a carboxylic acid, it can participate in acid-base reactions and may form salts or esters. This compound is of interest in medicinal chemistry and pharmacology, where it may be explored for its therapeutic potential. Its specific applications and biological activities would depend on further research and characterization, including studies on its mechanism of action and efficacy in relevant biological systems.

Formula: C₁₈H₁₄ClNO₄

InChI: InChI=1S/C18H14ClNO4/c1-23-10-6-7-16(24-2)13(8-10)15-9-12(18(21)22)11-4-3-5-14(19)17(11)20-15/h3-9H,1-2H3,(H,21,22)

InChI key: InChIKey=MLGPTQXMWWXLTH-UHFFFAOYSA-N

SMILES: O(C)C1=C(C2=NC3=C(C(C(O)=O)=C2)C=CC=C3Cl)C=C(OC)C=C1

Synonyms:

• 4-Quinolinecarboxylic acid, 8-chloro-2-(2,5-dimethoxyphenyl)-
• 8-Chloro-2-(2,5-dimethoxyphenyl)-4-quinolinecarboxylic acid