CAS 862785-62-4

7-Chloro-2-(4-chlorophenyl)-3,8-dimethyl-4-quinolinecarboxylic acid

Description:

7-Chloro-2-(4-chlorophenyl)-3,8-dimethyl-4-quinolinecarboxylic acid is a synthetic organic compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This substance features multiple functional groups, including a carboxylic acid and chlorophenyl moiety, contributing to its potential biological activity. The presence of chlorine atoms enhances its lipophilicity and may influence its interaction with biological targets. The dimethyl groups at positions 3 and 8 of the quinoline ring can affect the compound's steric properties and reactivity. This compound is of interest in medicinal chemistry, particularly for its potential applications in developing pharmaceuticals, as quinoline derivatives are known for their diverse biological activities, including antimicrobial and antimalarial properties. Its molecular structure suggests it may exhibit specific interactions with enzymes or receptors, making it a candidate for further research in drug development. As with many chemical substances, safety and handling precautions should be observed due to potential toxicity or environmental impact.

Formula: C₁₈H₁₃Cl₂NO₂

InChI: InChI=1S/C18H13Cl2NO2/c1-9-14(20)8-7-13-15(18(22)23)10(2)16(21-17(9)13)11-3-5-12(19)6-4-11/h3-8H,1-2H3,(H,22,23)

InChI key: InChIKey=VMKRTBNGLFHQNX-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C2=C(N=C(C1C)C3=CC=C(Cl)C=C3)C(C)=C(Cl)C=C2

Synonyms:

• 7-Chloro-2-(4-chlorophenyl)-3,8-dimethyl-4-quinolinecarboxylic acid
• 4-Quinolinecarboxylic acid, 7-chloro-2-(4-chlorophenyl)-3,8-dimethyl-