CAS 862812-98-4

5-(5,6-dimethoxy-1H-benzimidazol-1-yl)-3-{[2-(methylsulfonyl)benzyl]oxy}thiophene-2-carbonitrile

Description:

5-(5,6-Dimethoxy-1H-benzimidazol-1-yl)-3-{[2-(methylsulfonyl)benzyl]oxy}thiophene-2-carbonitrile is a complex organic compound characterized by its unique structural features, which include a benzimidazole moiety, a thiophene ring, and a carbonitrile functional group. The presence of methoxy groups enhances its solubility and may influence its electronic properties, while the methylsulfonyl group contributes to its potential reactivity and biological activity. This compound is likely to exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. Additionally, the compound's stability, solubility, and reactivity can be influenced by the substituents present, making it a candidate for further research in drug development. Overall, this substance exemplifies the complexity and diversity of organic compounds used in various scientific fields, particularly in the development of new pharmaceuticals.

Formula: C₂₂H₁₉N₃O₅S₂

InChI: InChI=1/C22H19N3O5S2/c1-28-17-8-15-16(9-18(17)29-2)25(13-24-15)22-10-19(20(11-23)31-22)30-12-14-6-4-5-7-21(14)32(3,26)27/h4-10,13H,12H2,1-3H3

SMILES: COc1cc2c(cc1OC)n(cn2)c1cc(c(C#N)s1)OCc1ccccc1S(=O)(=O)C

CAY10576

CAS: 862812-98-4

Formula: C₂₂H₁₉N₃O₅S₂

Purity: 97%

Molecular weight: 469.5334

Ref: IN-DA004JGY

GSK319347A

CAS: 862812-98-4

GSK319347A

Purity: ≥98%

Molecular weight: 469.53g/mol

Ref: 54-BUP04401

GSK 319347A

Controlled Product

CAS: 862812-98-4

Formula: C₂₂H₁₉N₃O₅S₂

Color and Shape: Neat

Molecular weight: 469.533

Ref: TR-G797610

GSK 319347A

CAS: 862812-98-4

GSK 319347A is a chemical compound that belongs to the group of chemokines. It has been shown to have anti-cancer properties, in particular for colorectal cancer and myocardial infarcts. GSK 319347A has also been shown to activate stem cells and increase the growth of cancer cells. The mechanism by which GSK319347A activates stem cells is not yet known, but it may be due to its ability to inhibit growth factor signaling pathways or its ability to bind with chemokine receptors.

Formula: C₂₂H₁₉N₃O₅S₂

Purity: Min. 95%

Molecular weight: 469.53 g/mol

Ref: 3D-MJB81298

GSK319347A

CAS: 862812-98-4

GSK319347A is a dual inhibitor of TBK1 and IKKε that inhibits IKK2 and can be used to study bladder and lung adenocarcinomas.

Formula: C₂₂H₁₉N₃O₅S₂

Purity: 98.42%

Color and Shape: Solid

Molecular weight: 469.53

Ref: TM-T15558