CAS 862812-98-4
:5-(5,6-dimethoxy-1H-benzimidazol-1-yl)-3-{[2-(methylsulfonyl)benzyl]oxy}thiophene-2-carbonitrile
Description:
5-(5,6-Dimethoxy-1H-benzimidazol-1-yl)-3-{[2-(methylsulfonyl)benzyl]oxy}thiophene-2-carbonitrile is a complex organic compound characterized by its unique structural features, which include a benzimidazole moiety, a thiophene ring, and a carbonitrile functional group. The presence of methoxy groups enhances its solubility and may influence its electronic properties, while the methylsulfonyl group contributes to its potential reactivity and biological activity. This compound is likely to exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. Additionally, the compound's stability, solubility, and reactivity can be influenced by the substituents present, making it a candidate for further research in drug development. Overall, this substance exemplifies the complexity and diversity of organic compounds used in various scientific fields, particularly in the development of new pharmaceuticals.
Formula:C22H19N3O5S2
InChI:InChI=1/C22H19N3O5S2/c1-28-17-8-15-16(9-18(17)29-2)25(13-24-15)22-10-19(20(11-23)31-22)30-12-14-6-4-5-7-21(14)32(3,26)27/h4-10,13H,12H2,1-3H3
SMILES:COc1cc2c(cc1OC)n(cn2)c1cc(c(C#N)s1)OCc1ccccc1S(=O)(=O)C
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
GSK 319347A
CAS:GSK 319347A is a chemical compound that belongs to the group of chemokines. It has been shown to have anti-cancer properties, in particular for colorectal cancer and myocardial infarcts. GSK 319347A has also been shown to activate stem cells and increase the growth of cancer cells. The mechanism by which GSK319347A activates stem cells is not yet known, but it may be due to its ability to inhibit growth factor signaling pathways or its ability to bind with chemokine receptors.Formula:C22H19N3O5S2Purity:Min. 95%Molecular weight:469.53 g/molGSK319347A
CAS:GSK319347A is a dual inhibitor of TBK1 and IKKε that inhibits IKK2 and can be used to study bladder and lung adenocarcinomas.Formula:C22H19N3O5S2Purity:98.42%Color and Shape:SolidMolecular weight:469.53




