CAS 86282-92-0

15(S)-hydroxy-(5Z,8Z,11Z,13E,17Z)-*eicosapentaeno

Description:

15(S)-hydroxy-(5Z,8Z,11Z,13E,17Z)-eicosapentaenoic acid, commonly referred to as 15-hydroxyeicosapentaenoic acid (15-HEPE), is a bioactive lipid derived from eicosapentaenoic acid (EPA), an omega-3 fatty acid. This compound is characterized by its hydroxyl group at the 15th carbon position, which contributes to its unique biological activities. 15-HEPE is known for its anti-inflammatory properties and potential roles in modulating immune responses. It is involved in various physiological processes, including cell signaling and the resolution of inflammation. The compound is of interest in research related to cardiovascular health, neuroprotection, and metabolic disorders. Its structure, featuring multiple double bonds, contributes to its reactivity and interaction with biological membranes. As a metabolite of EPA, 15-HEPE is part of a broader class of eicosanoids that play critical roles in human health, making it a subject of ongoing scientific investigation.

Formula: C₂₀H₃₀O₃

InChI: InChI=1/C20H30O3/c1-2-3-13-16-19(21)17-14-11-9-7-5-4-6-8-10-12-15-18-20(22)23/h3-5,8-11,13-14,17,19,21H,2,6-7,12,15-16,18H2,1H3,(H,22,23)/b5-4-,10-8-,11-9-,13-3-,17-14+/t19-/m0/s1

Synonyms:

• (5Z,8Z,11Z,13E,15S,17Z)-15-hydroxyicosa-5,8,11,13,17-pentaenoic acid

15(S)-Hydroxy-(5Z,8Z,11Z,13E,17Z)-eicosapentaenoic acid

CAS: 86282-92-0

Formula: C₂₀H₃₀O₃

Molecular weight: 318.45

Ref: 7W-GL2388

15(S)-hydroxy-5(Z),8(Z),11(Z),13(E),17(Z)-eicosapentaenoic acid

CAS: 86282-92-0

Formula: C20H30O3

Purity: >98%

Color and Shape: In solution, Ethanol

Molecular weight: 318.45

Ref: 48-14-2093

15(S)-HEPE

CAS: 86282-92-0

15(S)-HEPE, a monohydroxy acid, is formed from EPA via 15-LO and inhibits RBL-1 cell 5-LO at 28 μM IC50.

Formula: C₂₀H₃₀O₃

Color and Shape: Solid

Molecular weight: 318.45

Ref: TM-T37266