CAS 862847-75-4
:7-Bromo-9,9,9',9'-tetraethyl-2,2'-bifluorene
Description:
7-Bromo-9,9,9',9'-tetraethyl-2,2'-bifluorene is an organic compound characterized by its unique structure, which includes a bifluorene backbone with ethyl substituents and a bromine atom. This compound typically exhibits properties associated with polycyclic aromatic hydrocarbons, such as fluorescence and potential applications in organic electronics and photonics. The presence of the bromine atom can enhance its reactivity, making it useful in various chemical reactions, including cross-coupling reactions. The ethyl groups contribute to its solubility in organic solvents and may influence its electronic properties. Additionally, the compound's molecular structure suggests potential for interesting photophysical behavior, which can be explored in materials science and organic synthesis. As with many brominated compounds, care should be taken regarding its environmental impact and toxicity. Overall, 7-Bromo-9,9,9',9'-tetraethyl-2,2'-bifluorene represents a fascinating subject for research in organic chemistry and materials science.
Formula:C34H33Br
InChI:InChI=1/C34H33Br/c1-5-33(6-2)29-12-10-9-11-25(29)26-16-13-22(19-30(26)33)23-14-17-27-28-18-15-24(35)21-32(28)34(7-3,8-4)31(27)20-23/h9-21H,5-8H2,1-4H3
SMILES:CCC1(CC)c2ccccc2c2ccc(cc12)c1ccc2c3ccc(cc3C(CC)(CC)c2c1)Br
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.