CAS 862911-98-6

2,2-bis(3-triethoxysilylpropoxymethyl)butan-1-ol

Description:

2,2-bis(3-triethoxysilylpropoxymethyl)butan-1-ol, with CAS number 862911-98-6, is a silane compound characterized by its multifunctional siloxane structure. This compound features two triethoxysilyl groups attached to a butan-1-ol backbone, which enhances its reactivity and compatibility with various substrates. The presence of ethoxy groups allows for hydrolysis and subsequent condensation reactions, facilitating the formation of siloxane networks upon exposure to moisture. This property makes it useful as a coupling agent or adhesion promoter in various applications, including coatings, sealants, and composites. Additionally, the compound exhibits good solubility in organic solvents and can improve the mechanical and thermal properties of materials when incorporated into polymer matrices. Its ability to bond with both organic and inorganic materials makes it valuable in the development of advanced materials and surface treatments. Overall, 2,2-bis(3-triethoxysilylpropoxymethyl)butan-1-ol is a versatile chemical with significant potential in materials science and engineering.

Formula: C₂₄H₅₄O₉Si₂

InChI: InChI=1/C24H54O9Si2/c1-8-24(21-25,22-26-17-15-19-34(28-9-2,29-10-3)30-11-4)23-27-18-16-20-35(31-12-5,32-13-6)33-14-7/h25H,8-23H2,1-7H3

SMILES: CCC(CO)(COCCC[Si](OCC)(OCC)OCC)COCCC[Si](OCC)(OCC)OCC