CAS 86293-25-6
:Isoiridogermanal
Description:
Isoiridogermanal, with the CAS number 86293-25-6, is a chemical compound that belongs to the class of organometallic compounds, specifically those containing germanium. It is characterized by its unique molecular structure, which includes a germanium atom bonded to organic groups. This compound is typically studied for its potential applications in materials science and catalysis due to the interesting properties imparted by the germanium atom. Isoiridogermanal may exhibit specific reactivity patterns, including the ability to participate in various chemical reactions, such as nucleophilic substitutions or coordination with other metal centers. Its physical properties, such as solubility and stability, can vary depending on the substituents attached to the germanium atom. As with many organometallic compounds, safety precautions are essential when handling isoiridogermanal, as it may pose health risks or environmental hazards. Further research is often necessary to fully understand its behavior and potential applications in various fields, including organic synthesis and materials development.
Formula:C30H50O4
InChI:InChI=1S/C30H50O4/c1-22(2)11-8-12-23(3)15-16-28(33)24(4)13-9-18-29(6)27(14-10-20-31)26(25(5)21-32)17-19-30(29,7)34/h11,13,15,21,27-28,31,33-34H,8-10,12,14,16-20H2,1-7H3/b23-15+,24-13+,26-25-/t27-,28-,29+,30+/m1/s1
InChI key:InChIKey=KVTCHSWVSFQOTP-YFPNSAJKSA-N
SMILES:C(CCO)[C@H]/1[C@@](CC/C=C(/[C@@H](C/C=C(/CCC=C(C)C)\C)O)\C)(C)[C@@](C)(O)CC\C1=C(\C=O)/C
Synonyms:- (2Z)-2-[(2R,3S,4S)-4-Hydroxy-2-(3-hydroxypropyl)-3-[(3E,5R,7E)-5-hydroxy-4,8,12-trimethyl-3,7,11-tridecatrien-1-yl]-3,4-dimethylcyclohexylidene]propanal
- Propanal, 2-[(2R,3S,4S)-4-hydroxy-2-(3-hydroxypropyl)-3-[(3E,5R,7E)-5-hydroxy-4,8,12-trimethyl-3,7,11-tridecatrienyl]-3,4-dimethylcyclohexylidene]-, (2Z)-
- Propanal, 2-[(2R,3S,4S)-4-hydroxy-2-(3-hydroxypropyl)-3-[(3E,5R,7E)-5-hydroxy-4,8,12-trimethyl-3,7,11-tridecatrien-1-yl]-3,4-dimethylcyclohexylidene]-, (2Z)-
- 16-Hydroxyiridal
- Isoiridogermanal
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Propanal, 2-[(2R,3S,4S)-4-hydroxy-2-(3-hydroxypropyl)-3-[(3E,5R,7E)-5-hydroxy-4,8,12-trimethyl-3,7,11-tridecatrien-1-yl]-3,4-dimethylcyclohexylidene]-, (2Z)-
CAS:Formula:C30H50O4Purity:97.0%Molecular weight:474.7156Isoiridogermanal
CAS:Isoiridogermanal shows similar cytotoxicity with IG(50) around 11 microM and 23 microM against MCF-7 and C32 cell lines, respectively.Formula:C30H50O4Purity:98%Color and Shape:SolidMolecular weight:474.72Isoiridogermanal
CAS:Isoiridogermanal is a complex organic compound, specifically a sesquiterpene derivative, that has garnered attention within the scientific community. It is primarily sourced from natural plant materials, particularly those within the family Iridaceae, known for their aromatic properties. The compound is typically isolated through advanced extraction and distillation processes that maintain its structural integrity and potency.Formula:C30H50O4Purity:Min. 95%Molecular weight:474.7 g/mol


