CAS 863-76-3
:α-Amyrin acetate
Description:
α-Amyrin acetate is a triterpenoid compound derived from the natural product α-amyrin, which is commonly found in various plant species, particularly in the resin of certain trees. It is characterized by its molecular formula, which reflects its structure as an acetate derivative of α-amyrin. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. α-Amyrin acetate is known for its potential biological activities, including anti-inflammatory, antimicrobial, and antioxidant properties, making it of interest in pharmacological and cosmetic applications. Its structure features a tetracyclic triterpene backbone, which contributes to its stability and reactivity. Additionally, α-amyrin acetate is often studied for its role in traditional medicine and its potential therapeutic benefits. As with many natural compounds, its extraction and purification can vary, influencing its characteristics and applications in various fields, including herbal medicine and natural product chemistry.
Formula:C32H52O2
InChI:InChI=1S/C32H52O2/c1-20-12-15-29(6)18-19-31(8)23(27(29)21(20)2)10-11-25-30(7)16-14-26(34-22(3)33)28(4,5)24(30)13-17-32(25,31)9/h10,20-21,24-27H,11-19H2,1-9H3/t20-,21+,24+,25-,26+,27+,29-,30+,31-,32-/m1/s1
InChI key:InChIKey=UDXDFWBZZQHDRO-NSTYLNEOSA-N
SMILES:C[C@]12[C@@]3(C)C([C@]4([C@@](C)(CC3)CC[C@@H](C)[C@@H]4C)[H])=CC[C@@]1([C@]5(C)[C@@](CC2)(C(C)(C)[C@@H](OC(C)=O)CC5)[H])[H]
Synonyms:- .alpha.-Amyrin acetate
- 3-O-Acetyl-α-amyrin
- NSC 160881
- Urs-12-en-3-ol, 3-acetate, (3β)-
- Urs-12-en-3-ol, acetate, (3.beta.)-
- Urs-12-en-3-ol, acetate, (3β)-
- Urs-12-en-3.beta.-ol, acetate
- Urs-12-en-3beta-ol, acetate (8CI)
- Urs-12-en-3β-ol, acetate
- α-Acetylamyrin
- α-Amyrenyl acetate
- α-Amyrin acetate
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
α-Amyrin acetate
CAS:α-Amyrin acetate is a natural product( triterpeno), with anti-inflammatory activity, antispasmodic profile and the relaxant effect.Formula:C32H52O2Purity:98%Color and Shape:White Crystalline PowderMolecular weight:468.75I+-Amyrin acetate
CAS:I+-Amyrin acetate is a naturally occurring triterpenoid compound, which is derived from various plant sources, particularly those belonging to the Sapotaceae and Euphorbiaceae families. Its structure consists of a pentacyclic triterpene backbone, specifically in the form of an acetate ester. This compound's biochemical mode of action primarily involves the modulation of inflammatory pathways, where it acts by inhibiting the synthesis and action of pro-inflammatory mediators such as prostaglandins and leukotrienes.Formula:C32H52O2Purity:Min. 95%Molecular weight:468.8 g/molUrs-12-en-3-ol,3-acetate, (3b)-
CAS:Formula:C32H52O2Purity:98%Color and Shape:SolidMolecular weight:468.7541




