CAS 863031-42-9
:(4R)-2,4-Diphenyl-1,3,2-dioxaborolane
Description:
(4R)-2,4-Diphenyl-1,3,2-dioxaborolane is a boron-containing organic compound characterized by its unique dioxaborolane ring structure, which features two phenyl groups attached to the boron atom. This compound is typically used in organic synthesis, particularly in the formation of carbon-boron bonds, which are crucial for various coupling reactions in medicinal chemistry and materials science. The presence of the dioxaborolane moiety enhances its reactivity and stability, making it a valuable intermediate in the synthesis of complex organic molecules. Its chirality, indicated by the (4R) designation, suggests that it may exhibit specific stereochemical properties that can influence its reactivity and interactions in biological systems. Additionally, the compound's solubility and stability in various solvents can vary, affecting its application in different chemical environments. Overall, (4R)-2,4-Diphenyl-1,3,2-dioxaborolane is an important compound in the field of synthetic organic chemistry, particularly for its role in facilitating reactions that form carbon-carbon bonds.
Formula:C14H13BO2
InChI:InChI=1S/C14H13BO2/c1-3-7-12(8-4-1)14-11-16-15(17-14)13-9-5-2-6-10-13/h1-10,14H,11H2/t14-/m0/s1
InChI key:InChIKey=CDBQFRPSHCVYPA-AWEZNQCLSA-N
SMILES:B1(O[C@@H](CO1)C2=CC=CC=C2)C3=CC=CC=C3
Synonyms:- (4R)-2,4-Diphenyl-1,3,2-dioxaborolane
- 1,3,2-Dioxaborolane, 2,4-diphenyl-, (4R)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
