CAS 86309-06-0
:2-(2,4-dichlorophenoxy)benzaldehyde
Description:
2-(2,4-Dichlorophenoxy)benzaldehyde is an organic compound characterized by its aromatic structure, which includes a benzaldehyde functional group and a dichlorophenoxy substituent. The presence of the two chlorine atoms on the phenoxy ring enhances its reactivity and influences its physical properties, such as solubility and boiling point. This compound typically appears as a pale yellow to light brown solid or liquid, depending on its purity and specific conditions. It is known for its applications in organic synthesis, particularly in the development of agrochemicals and pharmaceuticals. The compound may exhibit biological activity, making it of interest in medicinal chemistry. Additionally, it is important to handle this substance with care due to potential toxicity associated with chlorinated aromatic compounds. Safety data sheets should be consulted for proper handling and disposal guidelines. Overall, 2-(2,4-dichlorophenoxy)benzaldehyde is a significant compound in various chemical research and industrial applications.
Formula:C13H8Cl2O2
InChI:InChI=1/C13H8Cl2O2/c14-10-5-6-13(11(15)7-10)17-12-4-2-1-3-9(12)8-16/h1-8H
SMILES:c1ccc(c(c1)C=O)Oc1ccc(cc1Cl)Cl
Synonyms:- Benzaldehyde, 2-(2,4-Dichlorophenoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
