CAS 86311-36-6

Ethanamine, 2-azido-N,N-dimethyl-, hydrochloride (1:1)

Description:

Ethanamine, 2-azido-N,N-dimethyl-, hydrochloride (1:1), with the CAS number 86311-36-6, is a chemical compound characterized by its azido functional group and amine structure. It is a salt formed from the combination of 2-azido-N,N-dimethyl-ethanamine and hydrochloric acid, resulting in a hydrochloride salt. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride moiety. The azido group (-N3) is known for its reactivity, particularly in organic synthesis, where it can participate in various reactions, including nucleophilic substitutions and cycloadditions. The presence of the dimethylamino group enhances its basicity and potential for forming hydrogen bonds. Safety precautions are essential when handling this compound, as azides can be sensitive and potentially explosive under certain conditions. Overall, 2-azido-N,N-dimethyl-ethanamine hydrochloride is of interest in synthetic organic chemistry and may have applications in medicinal chemistry and materials science.

Formula: C₄H₁₀N₄·ClH

InChI: InChI=1S/C4H10N4.ClH/c1-8(2)4-3-6-7-5;/h3-4H2,1-2H3;1H

InChI key: InChIKey=HRXMQXUFFLUVQK-UHFFFAOYSA-N

SMILES: C(CN=[N+]=[N-])N(C)C.Cl

Synonyms:

• Ethanamine, 2-azido-N,N-dimethyl-, monohydrochloride
• (2-Azidoethyl)dimethylamine hydrochloride
• Ethanamine, 2-azido-N,N-dimethyl-, hydrochloride (1:1)

(2-Azidoethyl)dimethylamine hydrochloride

Controlled Product

CAS: 86311-36-6

Versatile small molecule scaffold

Formula: C₄H₁₁ClN₄

Purity: Min. 95%

Molecular weight: 150.61 g/mol

Ref: 3D-LDA31136