CAS 863127-76-8
:(E)-N-(2-Chloro-6-methylphenyl)-3-ethoxy acrylamide
Description:
(E)-N-(2-Chloro-6-methylphenyl)-3-ethoxy acrylamide is a synthetic organic compound characterized by its acrylamide structure, which features a double bond between the carbon atoms in the acrylamide moiety. The presence of the 2-chloro-6-methylphenyl group contributes to its unique chemical properties, potentially influencing its reactivity and biological activity. The ethoxy group enhances its solubility in organic solvents, making it suitable for various applications in organic synthesis and medicinal chemistry. This compound may exhibit specific interactions with biological targets due to its structural features, which could be of interest in drug development or as a research tool. Additionally, the (E) configuration indicates the spatial arrangement of substituents around the double bond, which can significantly affect the compound's physical and chemical properties, including its stability and reactivity. As with many acrylamide derivatives, safety considerations regarding toxicity and environmental impact should be taken into account when handling or utilizing this compound in research or industrial applications.
Formula:C12H14ClNO2
InChI:InChI=1/C12H14ClNO2/c1-3-16-8-7-11(15)14-12-9(2)5-4-6-10(12)13/h4-8H,3H2,1-2H3,(H,14,15)/b8-7+
Synonyms:- (2E)-N-(2-Chloro-6-methylphenyl)-3-ethoxy-2-propenamide
- (E)-N-(2-chloro-6-methyl-phenyl)-3-ethoxyl acrylamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
(E)-N-(2-Chloro-6-methylphenyl)-3-ethoxyacrylamide
CAS:Formula:C12H14ClNO2Purity:97%Color and Shape:SolidMolecular weight:239.6981(E)-N-(2-Chloro-6-methylphenyl)-3-ethoxyacrylamide
CAS:(E)-N-(2-Chloro-6-methylphenyl)-3-ethoxyacrylamidePurity:97%Molecular weight:239.70g/mol(E)-N-(2-Chloro-6-methylphenyl)-3-ethoxyacrylamide
CAS:(E)-N-(2-Chloro-6-methylphenyl)-3-ethoxyacrylamide is a reagent and research chemical that can be used as a building block in the synthesis of other compounds. It is also a versatile building block in organic chemistry. (E)-N-(2-Chloro-6-methylphenyl)-3-ethoxyacrylamide has been shown to be an effective intermediate for the synthesis of various complex compounds, such as pharmaceuticals and pesticides. This compound is also a useful scaffold for the synthesis of other fine chemicals.
Formula:C12H14ClNO2Purity:(¹H-Nmr) Min. 95 Area-%Color and Shape:PowderMolecular weight:239.7 g/mol(E)-N-(2-Chloro-6-methylphenyl)-3-ethoxyacrylamide
CAS:Formula:C12H14ClNO2Purity:95.0%Color and Shape:SolidMolecular weight:239.7






