CAS 86318-61-8
:(tert-butyldimethylsilyl)acetylene
Description:
(tert-Butyldimethylsilyl)acetylene is an organosilicon compound characterized by the presence of a tert-butyldimethylsilyl group attached to an acetylene moiety. This compound typically appears as a colorless to pale yellow liquid and is known for its stability under standard conditions. It has a relatively low boiling point, which is common for small organic molecules. The tert-butyldimethylsilyl group enhances the compound's hydrophobicity and provides steric hindrance, making it useful in various synthetic applications, particularly in organic synthesis and as a protecting group for functional groups in chemical reactions. The presence of the acetylene functional group allows for further reactivity, enabling the formation of carbon-carbon bonds through coupling reactions. Additionally, (tert-butyldimethylsilyl)acetylene can be utilized in the preparation of more complex molecules, including pharmaceuticals and agrochemicals. Safety precautions should be taken when handling this compound, as it may pose risks associated with flammability and potential toxicity.
Formula:C8H16Si
InChI:InChI=1/C8H16Si/c1-7-9(5,6)8(2,3)4/h1H,2-6H3
SMILES:C#C[Si](C)(C)C(C)(C)C
Synonyms:- tert-Butyldimethylsilylacetylene
- Tert-Butyl(Ethynyl)Dimethylsilane
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(tert-Butyldimethylsilyl)acetylene
CAS:Formula:C8H16SiPurity:>97.0%(GC)Color and Shape:White or Colorless to Almost white or Almost colorless powder to lump to clear liquidMolecular weight:140.30tert-Butyldimethylsilylacetylene, 98%
CAS:tert-Butyldimethylsilylacetylene may be used in the synthesis of -alkynylketone and -alkynyl aldehydes. It participates in Cadiot-Chodkiewicz cross-coupling reaction with various bromoalkynes to afford synthetically useful unsymmetrical diynes. This Thermo Scientific Chemicals brand product was origFormula:C8H16SiPurity:98%Molecular weight:140.3[(tert-Butyl)dimethylsilyl]acetylene
CAS:[(tert-Butyl)dimethylsilyl]acetyleneFormula:C8H16SiPurity:99%Color and Shape:Colourless To Pale Yellow LiquidMolecular weight:140.29813g/moltert-Butyldimethylsilylacetylene
CAS:S03339 - tert-Butyldimethylsilylacetylene
Formula:C8H16SiPurity:>97.0%(GC)Color and Shape:Liquid, Low Melting SolidMolecular weight:140.301



