CAS 863182-57-4

7-Chloro-8-methyl-2-[4-(2-methylpropyl)phenyl]-4-quinolinecarboxylic acid

Description:

7-Chloro-8-methyl-2-[4-(2-methylpropyl)phenyl]-4-quinolinecarboxylic acid is a synthetic organic compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This substance features a carboxylic acid functional group, contributing to its acidic properties and potential solubility in polar solvents. The presence of chlorine and methyl groups on the quinoline ring enhances its lipophilicity, which may influence its biological activity and interaction with various biological targets. The compound also contains a phenyl group substituted with a branched alkyl chain, which can affect its steric properties and overall reactivity. Such structural characteristics suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The compound's unique arrangement of functional groups may also lead to interesting interactions in biological systems, making it a candidate for further research in drug discovery and development. As with many synthetic compounds, safety and handling precautions should be observed due to potential toxicity or environmental impact.

Formula: C₂₁H₂₀ClNO₂

InChI: InChI=1S/C21H20ClNO2/c1-12(2)10-14-4-6-15(7-5-14)19-11-17(21(24)25)16-8-9-18(22)13(3)20(16)23-19/h4-9,11-12H,10H2,1-3H3,(H,24,25)

InChI key: InChIKey=WNTFRNGODURECC-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C2=C(N=C(C1)C3=CC=C(CC(C)C)C=C3)C(C)=C(Cl)C=C2

Synonyms:

• 4-Quinolinecarboxylic acid, 7-chloro-8-methyl-2-[4-(2-methylpropyl)phenyl]-
• 7-Chloro-8-methyl-2-[4-(2-methylpropyl)phenyl]-4-quinolinecarboxylic acid