CymitQuimica logo

CAS 863182-58-5

:

7-Chloro-2-[4-(1,1-dimethylethyl)phenyl]-8-methyl-4-quinolinecarboxylic acid

Description:
7-Chloro-2-[4-(1,1-dimethylethyl)phenyl]-8-methyl-4-quinolinecarboxylic acid, with the CAS number 863182-58-5, is a synthetic organic compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This substance features a chloro group at the 7-position and a carboxylic acid functional group at the 4-position of the quinoline ring, contributing to its potential acidity and reactivity. The presence of a tert-butyl group and a methyl group enhances its hydrophobic characteristics, which may influence its solubility and biological activity. The compound is of interest in medicinal chemistry, particularly for its potential applications in pharmaceuticals, as quinoline derivatives are known for various biological activities, including antimicrobial and anti-inflammatory properties. Its molecular structure suggests that it may interact with biological targets, making it a candidate for further research in drug development. Proper handling and safety measures should be observed due to its chemical nature and potential biological effects.
Formula:C21H20ClNO2
InChI:InChI=1S/C21H20ClNO2/c1-12-17(22)10-9-15-16(20(24)25)11-18(23-19(12)15)13-5-7-14(8-6-13)21(2,3)4/h5-11H,1-4H3,(H,24,25)
InChI key:InChIKey=HUBDTESIVRBGJC-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C2=C(N=C(C1)C3=CC=C(C(C)(C)C)C=C3)C(C)=C(Cl)C=C2
Synonyms:
  • 7-Chloro-2-[4-(1,1-dimethylethyl)phenyl]-8-methyl-4-quinolinecarboxylic acid
  • 4-Quinolinecarboxylic acid, 7-chloro-2-[4-(1,1-dimethylethyl)phenyl]-8-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.