CAS 863185-05-1

8-Chloro-2-[4-(2-methylpropoxy)phenyl]-4-quinolinecarboxylic acid

Description:

8-Chloro-2-[4-(2-methylpropoxy)phenyl]-4-quinolinecarboxylic acid is a synthetic organic compound characterized by its complex structure, which includes a quinoline core substituted with a chloro group and a phenyl ring that carries a branched alkoxy side chain. This compound typically exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many quinoline derivatives. Its molecular structure suggests potential biological activity, making it of interest in pharmaceutical research, particularly in the development of therapeutic agents. The presence of the chloro substituent may influence its reactivity and interaction with biological targets. Additionally, the branched alkoxy group can enhance lipophilicity, potentially affecting the compound's pharmacokinetics. As with many chemical substances, safety and handling precautions are essential, as the compound may pose health risks if not managed properly. Overall, 8-Chloro-2-[4-(2-methylpropoxy)phenyl]-4-quinolinecarboxylic acid represents a class of compounds that may have significant implications in medicinal chemistry.

Formula: C₂₀H₁₈ClNO₃

InChI: InChI=1S/C20H18ClNO3/c1-12(2)11-25-14-8-6-13(7-9-14)18-10-16(20(23)24)15-4-3-5-17(21)19(15)22-18/h3-10,12H,11H2,1-2H3,(H,23,24)

InChI key: InChIKey=XHWUFAQWILHRAZ-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C2=C(N=C(C1)C3=CC=C(OCC(C)C)C=C3)C(Cl)=CC=C2

Synonyms:

• 8-Chloro-2-[4-(2-methylpropoxy)phenyl]-4-quinolinecarboxylic acid
• 4-Quinolinecarboxylic acid, 8-chloro-2-[4-(2-methylpropoxy)phenyl]-