CAS 863185-11-9

7-Chloro-8-methyl-2-(3-propoxyphenyl)-4-quinolinecarboxylic acid

Description:

7-Chloro-8-methyl-2-(3-propoxyphenyl)-4-quinolinecarboxylic acid is a synthetic organic compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This compound features a chloro group at the 7-position and a methyl group at the 8-position of the quinoline ring, contributing to its unique chemical properties. The presence of a propoxyphenyl substituent at the 2-position enhances its lipophilicity and may influence its biological activity. As a carboxylic acid, it possesses acidic properties, allowing it to participate in various chemical reactions, such as esterification or amidation. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological activity often associated with quinoline derivatives. Its specific interactions, solubility, and stability would depend on the surrounding conditions, such as pH and solvent polarity. Overall, this compound represents a class of molecules that may exhibit significant pharmacological effects, warranting further investigation in drug development.

Formula: C₂₀H₁₈ClNO₃

InChI: InChI=1S/C20H18ClNO3/c1-3-9-25-14-6-4-5-13(10-14)18-11-16(20(23)24)15-7-8-17(21)12(2)19(15)22-18/h4-8,10-11H,3,9H2,1-2H3,(H,23,24)

InChI key: InChIKey=ONSZRARBCBDEBU-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C2=C(N=C(C1)C3=CC(OCCC)=CC=C3)C(C)=C(Cl)C=C2

Synonyms:

• 7-Chloro-8-methyl-2-(3-propoxyphenyl)-4-quinolinecarboxylic acid
• 4-Quinolinecarboxylic acid, 7-chloro-8-methyl-2-(3-propoxyphenyl)-