CAS 863222-23-5

2-Chloro-6-phenyl-1H-benzimidazole

Description:

2-Chloro-6-phenyl-1H-benzimidazole is a chemical compound characterized by its unique structure, which consists of a benzimidazole core substituted with a chlorine atom and a phenyl group. This compound typically exhibits properties associated with heterocyclic aromatic compounds, including potential biological activity and solubility in organic solvents. The presence of the chlorine atom can influence its reactivity and interaction with biological targets, making it of interest in medicinal chemistry. The phenyl group may enhance lipophilicity, potentially affecting its pharmacokinetic properties. Additionally, compounds like 2-Chloro-6-phenyl-1H-benzimidazole may exhibit fluorescence, which can be useful in various applications, including imaging and sensing. Its synthesis often involves multi-step organic reactions, and it may serve as a precursor or intermediate in the development of pharmaceuticals or agrochemicals. As with many chemical substances, safety data sheets should be consulted for handling and toxicity information, as the compound may pose health risks if not managed properly.

Formula: C₁₃H₉ClN₂

InChI: InChI=1S/C13H9ClN2/c14-13-15-11-7-6-10(8-12(11)16-13)9-4-2-1-3-5-9/h1-8H,(H,15,16)

InChI key: InChIKey=YKTKLYZAFCNQSY-UHFFFAOYSA-N

SMILES: ClC=1NC=2C(=CC=C(C2)C3=CC=CC=C3)N1

Synonyms:

• 2-Chloro-5-phenyl-1H-benzoimidazole
• 1H-Benzimidazole, 2-chloro-5-phenyl-
• 1H-Benzimidazole, 2-chloro-6-phenyl-
• 2-Chloro-6-phenyl-1H-benzimidazole