CAS 863238-73-7

4-(4,4,5,5-Tetramethyl-[1,3,2]dioxaborolan-2-yl)-1-trityl-1H-pyrazole

Description:

4-(4,4,5,5-Tetramethyl-[1,3,2]dioxaborolan-2-yl)-1-trityl-1H-pyrazole is a chemical compound characterized by its unique structural features, which include a pyrazole ring and a dioxaborolane moiety. The presence of the trityl group enhances its stability and solubility in organic solvents, making it useful in various synthetic applications. The dioxaborolane component is known for its ability to participate in boron-mediated reactions, such as Suzuki coupling, which is valuable in organic synthesis and materials science. This compound is typically used in research settings, particularly in the development of new pharmaceuticals or agrochemicals, due to its potential reactivity and functionalization capabilities. Its molecular structure suggests it may exhibit interesting electronic properties, which could be exploited in the design of novel materials or catalysts. As with many boron-containing compounds, it is essential to handle it with care, considering potential reactivity and stability under different conditions.

Formula: C₂₈H₂₉BN₂O₂

InChI: InChI=1/C28H29BN2O2/c1-26(2)27(3,4)33-29(32-26)25-20-30-31(21-25)28(22-14-8-5-9-15-22,23-16-10-6-11-17-23)24-18-12-7-13-19-24/h5-21H,1-4H3

SMILES: CC1(C)C(C)(C)OB(c2cnn(c2)C(c2ccccc2)(c2ccccc2)c2ccccc2)O1

4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-(triphenylmethyl)pyrazole

CAS: 863238-73-7

Formula: C₂₈H₂₉BN₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 436.3531

Ref: IN-DA004MBF

4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1-tritylpyrazole

CAS: 863238-73-7

4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1-tritylpyrazole

Purity: 97%

Molecular weight: 436.35g/mol

Ref: 54-OR79586

4-(4,4,5,5-tetramethyl-[1,3,2]dioxaborolan-2-yl)-1-trityl-1H-pyrazole

CAS: 863238-73-7

Formula: C₂₈H₂₉BN₂O₂

Purity: 95%

Color and Shape: Liquid

Molecular weight: 436.36

Ref: 10-F077370