
CAS 863248-51-5
:N-Methyl-1-(methylsulfonyl)-3-pyrrolidinamine
Description:
N-Methyl-1-(methylsulfonyl)-3-pyrrolidinamine, identified by its CAS number 863248-51-5, is a chemical compound that features a pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle. This compound is characterized by the presence of a methylsulfonyl group, which contributes to its unique chemical properties, including potential solubility in polar solvents and reactivity in various chemical reactions. The N-methyl substitution indicates that one of the nitrogen atoms in the pyrrolidine ring is methylated, which can influence the compound's biological activity and pharmacokinetics. Typically, compounds of this nature may exhibit properties relevant to medicinal chemistry, such as potential use in drug development or as intermediates in organic synthesis. The presence of both the methyl and methylsulfonyl groups suggests that this compound may engage in hydrogen bonding and other intermolecular interactions, which can affect its stability and reactivity. Overall, N-Methyl-1-(methylsulfonyl)-3-pyrrolidinamine represents a class of compounds that may have significant applications in pharmaceuticals and chemical research.
Formula:C6H14N2O2S
InChI:InChI=1S/C6H14N2O2S/c1-7-6-3-4-8(5-6)11(2,9)10/h6-7H,3-5H2,1-2H3
InChI key:InChIKey=VTSUBOKMHFKQAN-UHFFFAOYSA-N
SMILES:S(C)(=O)(=O)N1CC(NC)CC1
Synonyms:- 3-(Methylamino)-1-(methylsulfonyl)pyrrolidine
- N-Methyl-1-(methylsulfonyl)-3-pyrrolidinamine
- 1-Methanesulfonyl-N-methylpyrrolidin-3-amine
- 3-Pyrrolidinamine, N-methyl-1-(methylsulfonyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.