CAS 86327-84-6
:[(3S,4S,5S,6R)-6-[[(6S,7S,8R,8aR)-7-acetamido-6-benzyloxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]oxy]-3,4,5-triacetoxy-tetrahydropyran-2-yl]methyl acetate
Description:
The chemical substance with the name "[(3S,4S,5S,6R)-6-[[(6S,7S,8R,8aR)-7-acetamido-6-benzyloxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]oxy]-3,4,5-triacetoxy-tetrahydropyran-2-yl]methyl acetate" and CAS number "86327-84-6" is a complex organic compound characterized by its intricate stereochemistry and multiple functional groups. It features a tetrahydropyran core, which is a six-membered ring containing oxygen, and is substituted with various acetoxy and benzyloxy groups, contributing to its reactivity and potential biological activity. The presence of acetamido and phenyl groups suggests potential interactions in biological systems, possibly indicating pharmaceutical relevance. The stereochemical configuration, denoted by the specific S and R designations, plays a crucial role in determining the compound's properties, including its solubility, stability, and interaction with biological targets. Overall, this compound exemplifies the complexity often found in natural products and synthetic pharmaceuticals, highlighting the importance of stereochemistry in chemical behavior and application.
Formula:C36H43NO15
InChI:InChI=1/C36H43NO15/c1-19(38)37-28-31(52-36-33(48-23(5)42)32(47-22(4)41)30(46-21(3)40)26(50-36)17-43-20(2)39)29-27(18-45-34(51-29)25-14-10-7-11-15-25)49-35(28)44-16-24-12-8-6-9-13-24/h6-15,26-36H,16-18H2,1-5H3,(H,37,38)/t26?,27?,28-,29-,30-,31+,32-,33-,34?,35-,36-/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Benzyl 2-acetamido-2-deoxy-4,6-O-benzylidene-3-O-(2,3,4,6-tetra-O-acetyl-b-D-galactopyranosyl)-a-D-galactopyranoside
CAS:<p>Benzyl 2-acetamido-2-deoxy-4,6-O-benzylidene-3-O-(2,3,4,6-tetra-O-acetyl-b-D-galactopyranosyl)-a-D galactopyranoside is a complex carbohydrate with a CAS number of 8632784. It is an oligosaccharide that is modified with methylation and glycosylation. This molecule has a molecular weight of 907.19 and the purity level is high at 99%. This product can be used for fluoroquinolone resistance research or as an intermediate for other chemical modifications.</p>Formula:C36H43NO15Purity:Min. 95%Molecular weight:729.72 g/mol

