CAS 86329-06-8
:[4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl](4-azidophenyl)methanone
Description:
The chemical substance known as [4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl](4-azidophenyl)methanone, with the CAS number 86329-06-8, is a synthetic organic compound that features a complex structure incorporating a quinazoline moiety, a piperazine ring, and an azide functional group. This compound is characterized by its potential biological activity, particularly in medicinal chemistry, where it may serve as a lead compound for the development of pharmaceuticals. The presence of the azide group suggests possible applications in click chemistry, allowing for further functionalization and conjugation with other molecules. The dimethoxy groups on the quinazoline ring enhance its solubility and may influence its interaction with biological targets. Additionally, the amino group can participate in hydrogen bonding, which is crucial for binding interactions in biological systems. Overall, this compound exemplifies the intricate design often found in drug discovery, combining various functional groups to optimize efficacy and selectivity.
Formula:C21H22N8O3
InChI:InChI=1/C21H22N8O3/c1-31-17-11-15-16(12-18(17)32-2)24-21(25-19(15)22)29-9-7-28(8-10-29)20(30)13-3-5-14(6-4-13)26-27-23/h3-6,11-12H,7-10H2,1-2H3,(H2,22,24,25)
Synonyms:- Piperazine, 1-(4-amino-6,7-dimethoxy-2-quinazolinyl)-4-(4-azidobenzoyl)-
- CP 59430
- 2-[4-(4-Azidobenzoyl)piperazin-1-yl]-4-amino-6,7-dimethoxyquinazoline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
CP 59430
CAS:CP 59430 is an azide analogue of prazosin. Prazosin is a highly selective α 1-adrenergic receptor antagonist.Formula:C21H22N8O3Color and Shape:SolidMolecular weight:434.45
