CAS 863296-73-5

1,1-Dimethylethyl 2-[(4-fluorophenyl)thioxomethyl]hydrazinecarboxylate

Description:

1,1-Dimethylethyl 2-[(4-fluorophenyl)thioxomethyl]hydrazinecarboxylate, with the CAS number 863296-73-5, is a chemical compound that features a hydrazinecarboxylate structure, which is characterized by the presence of a hydrazine functional group (-NH-NH-) linked to a carboxylate moiety. The compound also contains a thioxomethyl group, which introduces sulfur into its structure, enhancing its reactivity and potential biological activity. The presence of a 4-fluorophenyl group suggests that it may exhibit specific electronic properties due to the fluorine substituent, which can influence its interactions in biological systems. This compound may be of interest in medicinal chemistry and drug development, particularly for its potential pharmacological properties. Its unique structural features could contribute to its reactivity and interactions with biological targets, making it a candidate for further research in therapeutic applications. As with many chemical substances, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₂H₁₅FN₂O₂S

InChI: InChI=1S/C12H15FN2O2S/c1-12(2,3)17-11(16)15-14-10(18)8-4-6-9(13)7-5-8/h4-7H,1-3H3,(H,14,18)(H,15,16)

InChI key: InChIKey=AUJIDCIRIPPJTK-UHFFFAOYSA-N

SMILES: C(NNC(OC(C)(C)C)=O)(=S)C1=CC=C(F)C=C1

Synonyms:

• Hydrazinecarboxylic acid, 2-[(4-fluorophenyl)thioxomethyl]-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl 2-[(4-fluorophenyl)thioxomethyl]hydrazinecarboxylate