CAS 863305-85-5
:4-(2-Amino-4-thiazolyl)-2,6-dimethylphenol
Description:
4-(2-Amino-4-thiazolyl)-2,6-dimethylphenol, identified by its CAS number 863305-85-5, is a chemical compound characterized by its unique structural features, which include a phenolic group substituted with both thiazole and amino functionalities. This compound typically exhibits properties associated with both phenolic and thiazole derivatives, such as potential antioxidant activity and biological significance. The presence of the amino group suggests it may participate in hydrogen bonding, enhancing its solubility in polar solvents. Additionally, the thiazole ring can contribute to its reactivity and interaction with biological targets, making it of interest in medicinal chemistry. The dimethyl substitutions on the phenolic ring can influence its steric and electronic properties, potentially affecting its biological activity and stability. Overall, this compound may have applications in pharmaceuticals or agrochemicals, although specific uses would depend on further research into its biological effects and mechanisms of action.
Formula:C11H12N2OS
InChI:InChI=1S/C11H12N2OS/c1-6-3-8(4-7(2)10(6)14)9-5-15-11(12)13-9/h3-5,14H,1-2H3,(H2,12,13)
InChI key:InChIKey=WJPPIXIXQOGLGE-UHFFFAOYSA-N
SMILES:CC=1C=C(C=C(C)C1O)C=2N=C(N)SC2
Synonyms:- Phenol, 4-(2-amino-4-thiazolyl)-2,6-dimethyl-
- 4-(2-Amino-4-thiazolyl)-2,6-dimethylphenol
- 4-(2-AMINO-1,3-THIAZOL-4-YL)-2,6-DIMETHYLBENZENOL
- 4-(2-Imino-2,3-dihydrothiazol-4-yl)-2,6-dimethylphenol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.