CAS 863305-86-6
:Ethyl α-phenyl-4-(phenylmethyl)-1-piperazineacetate
Description:
Ethyl α-phenyl-4-(phenylmethyl)-1-piperazineacetate is a chemical compound characterized by its piperazine structure, which is a six-membered ring containing two nitrogen atoms. This compound features an ethyl ester functional group, contributing to its solubility and reactivity. The presence of phenyl groups enhances its lipophilicity, potentially influencing its biological activity and interaction with various receptors. The compound's molecular structure suggests it may exhibit properties relevant to pharmacology, particularly in the context of central nervous system activity, given the piperazine moiety's common association with psychoactive substances. Additionally, the acetate group may play a role in modulating the compound's pharmacokinetics, such as absorption and metabolism. As with many synthetic organic compounds, its stability, reactivity, and potential applications would depend on specific environmental conditions and the presence of other chemical entities. Safety data and handling precautions should be consulted, as with any chemical substance, to ensure proper use and minimize risks.
Formula:C21H26N2O2
InChI:InChI=1S/C21H26N2O2/c1-2-25-21(24)20(19-11-7-4-8-12-19)23-15-13-22(14-16-23)17-18-9-5-3-6-10-18/h3-12,20H,2,13-17H2,1H3
InChI key:InChIKey=MTPIBXSABLGXRQ-UHFFFAOYSA-N
SMILES:C(C(OCC)=O)(N1CCN(CC2=CC=CC=C2)CC1)C3=CC=CC=C3
Synonyms:- 1-Piperazineacetic acid, α-phenyl-4-(phenylmethyl)-, ethyl ester
- Ethyl α-phenyl-4-(phenylmethyl)-1-piperazineacetate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.