CymitQuimica logo

CAS 86336-36-9

:

1-(tert-butylsulfanyl)hydrazine-1,2-dicarboxylic acid

Description:
1-(tert-Butylsulfanyl)hydrazine-1,2-dicarboxylic acid is a chemical compound characterized by the presence of a hydrazine functional group, which is linked to a tert-butylsulfanyl group and two carboxylic acid moieties. This compound features a hydrazine backbone, which is known for its reactivity and ability to form various derivatives. The tert-butylsulfanyl group contributes to the compound's hydrophobic characteristics, potentially influencing its solubility and reactivity in different solvents. The two carboxylic acid groups provide acidic properties, allowing for potential interactions in biological systems or with other chemical species. The presence of both hydrophilic (carboxylic acid) and hydrophobic (tert-butylsulfanyl) components suggests that this compound may exhibit interesting behavior in terms of solubility and reactivity. Additionally, the compound may have applications in organic synthesis or as a building block in the development of pharmaceuticals or agrochemicals, although specific applications would depend on further research and exploration of its chemical properties.
Formula:C6H12N2O4S
InChI:InChI=1/C6H12N2O4S/c1-6(2,3)13-8(5(11)12)7-4(9)10/h7H,1-3H3,(H,9,10)(H,11,12)
SMILES:CC(C)(C)SN(C(=O)O)NC(=O)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.