CAS 863377-22-4

3-Morpholinophenylboronic acid

Description:

3-Morpholinophenylboronic acid is an organic compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is further substituted with a morpholine moiety. This compound typically exhibits properties such as being a white to off-white solid, and it is soluble in polar solvents like water and alcohols due to the presence of the boronic acid group, which can engage in hydrogen bonding. The morpholine ring contributes to its potential as a ligand in various chemical reactions, particularly in Suzuki coupling reactions, where it can facilitate the formation of carbon-carbon bonds. Additionally, the boronic acid functionality allows for reversible binding with diols, making it useful in biological applications, such as in the development of sensors or drug delivery systems. Its chemical structure also suggests potential applications in medicinal chemistry, particularly in the design of compounds targeting specific biological pathways. Overall, 3-Morpholinophenylboronic acid is a versatile compound with significant implications in both synthetic and medicinal chemistry.

Formula: C₁₀H₁₄BNO₃

InChI: InChI=1/C10H14BNO3/c13-11(14)9-2-1-3-10(8-9)12-4-6-15-7-5-12/h1-3,8,13-14H,4-7H2

SMILES: c1cc(cc(c1)N1CCOCC1)B(O)O

Synonyms:

• [3-(4-Morpholinyl)phenyl]boronic acid
• (3-Morpholin-4-Ylphenyl)Boronic Acid
• 3-(Morpholino)Phenylboronic Acid

(3-Morpholinophenyl)boronic acid

CAS: 863377-22-4

Formula: C₁₀H₁₄BNO₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 207.0341

Ref: IN-DA008ERS

3-Morpholinophenylboronic acid

CAS: 863377-22-4

3-Morpholinophenylboronic acid

Purity: 98%

Molecular weight: 207.03g/mol

Ref: 54-OR360139

(3-Morpholinophenyl)boronic acid

CAS: 863377-22-4

Formula: C₁₀H₁₄BNO₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 207.04

Ref: 10-F092822