CAS 863431-59-8

Methyl 3-chloro-2-thiopheneacetate

Description:

Methyl 3-chloro-2-thiopheneacetate is an organic compound characterized by its thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. This compound features a chloro substituent at the 3-position and an ester functional group derived from acetic acid at the 2-position of the thiophene ring. Its molecular structure contributes to its potential reactivity and applications in various chemical reactions, particularly in the synthesis of more complex organic molecules. The presence of the chlorine atom can enhance electrophilic reactivity, making it useful in substitution reactions. Additionally, the ester group can participate in hydrolysis or transesterification reactions. Methyl 3-chloro-2-thiopheneacetate may exhibit interesting biological activities, making it a candidate for further research in medicinal chemistry. Its physical properties, such as solubility and boiling point, are influenced by the functional groups present, and it is typically handled with standard safety precautions due to the presence of chlorine. Overall, this compound is of interest in both synthetic organic chemistry and potential pharmaceutical applications.

Formula: C₇H₇ClO₂S

InChI: InChI=1S/C7H7ClO2S/c1-10-7(9)4-6-5(8)2-3-11-6/h2-3H,4H2,1H3

InChI key: InChIKey=LGNNQZRBYUKRBQ-UHFFFAOYSA-N

SMILES: C(C(OC)=O)C1=C(Cl)C=CS1

Synonyms:

• 2-Thiopheneacetic acid, 3-chloro-, methyl ester
• 2-(3-Chloro-2-thienyl)acetic acid methyl ester
• Methyl 3-chloro-2-thiopheneacetate