
CAS 86344-87-8
:Thieno[3,2-b]pyridine-5-carbonitrile
Description:
Thieno[3,2-b]pyridine-5-carbonitrile is a heterocyclic organic compound characterized by its unique bicyclic structure, which consists of a thiophene ring fused to a pyridine ring. This compound features a cyano group (-C≡N) at the 5-position of the pyridine ring, contributing to its chemical reactivity and potential applications in various fields. Thieno[3,2-b]pyridine derivatives are often studied for their biological activities, including potential use as pharmaceuticals due to their ability to interact with biological targets. The presence of the cyano group enhances the compound's electron-withdrawing properties, which can influence its reactivity and solubility in different solvents. Additionally, this compound may exhibit interesting optical and electronic properties, making it a candidate for applications in organic electronics and materials science. Its synthesis typically involves multi-step reactions, and it can be characterized using techniques such as NMR spectroscopy, mass spectrometry, and X-ray crystallography to confirm its structure and purity.
Formula:C8H4N2S
InChI:InChI=1S/C8H4N2S/c9-5-6-1-2-8-7(10-6)3-4-11-8/h1-4H
InChI key:InChIKey=AJUZQNNCFOSRGN-UHFFFAOYSA-N
SMILES:C(#N)C=1N=C2C(=CC1)SC=C2
Synonyms:- Thieno[3,2-b]pyridine-5-carbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.