CAS 863443-05-4
:methyl 3-amino-5-[(4-fluorophenyl)methyl]pyridine-2-carboxylate
Description:
Methyl 3-amino-5-[(4-fluorophenyl)methyl]pyridine-2-carboxylate, identified by its CAS number 863443-05-4, is a chemical compound characterized by its pyridine ring structure, which is substituted at specific positions with an amino group and a carboxylate ester. The presence of the 4-fluorophenyl group introduces a fluorine atom, enhancing the compound's lipophilicity and potentially influencing its biological activity. This compound is likely to exhibit moderate to high solubility in organic solvents due to its ester functional group, while its polar amino and carboxylate groups may confer some degree of hydrophilicity. The molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as the modifications can affect receptor binding and metabolic stability. Additionally, the compound's unique combination of functional groups may contribute to its reactivity and interactions in various chemical environments, making it of interest for further research in drug design and synthesis.
Formula:C14H13FN2O2
InChI:InChI=1/C14H13FN2O2/c1-19-14(18)13-12(16)7-10(8-17-13)6-9-2-4-11(15)5-3-9/h2-5,7-8H,6,16H2,1H3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
