CAS 863492-35-7

2-Aminoquinoline-6-carboxylic acid benzyl ester

Description:

2-Aminoquinoline-6-carboxylic acid benzyl ester is a chemical compound characterized by its quinoline structure, which features a nitrogen-containing bicyclic aromatic system. This compound includes an amino group (-NH2) and a carboxylic acid moiety (-COOH) that is esterified with a benzyl group, enhancing its lipophilicity and potentially influencing its biological activity. The presence of the amino group suggests that it may participate in hydrogen bonding and act as a nucleophile in various chemical reactions. The benzyl ester functionality can provide stability and alter solubility, making it of interest in medicinal chemistry and drug design. Additionally, compounds of this type may exhibit various pharmacological properties, including antimicrobial or anticancer activities, due to the structural features of the quinoline ring. Its CAS number, 863492-35-7, allows for precise identification in chemical databases and literature. Overall, 2-Aminoquinoline-6-carboxylic acid benzyl ester represents a versatile scaffold for further chemical modifications and potential therapeutic applications.

Formula: C₁₇H₁₄N₂O₂

InChI: InChI=1/C17H14N2O2/c18-16-9-7-13-10-14(6-8-15(13)19-16)17(20)21-11-12-4-2-1-3-5-12/h1-10H,11H2,(H2,18,19)

SMILES: c1ccc(cc1)COC(=O)c1ccc2c(ccc(=N)[nH]2)c1

Synonyms:

• 6-Quinolinecarboxylic Acid, 2-Amino-, Phenylmethyl Ester
• Benzyl 2-aminoquinoline-6-carboxylate

Benzyl 2-aminoquinoline-6-carboxylate

CAS: 863492-35-7

Formula: C₁₇H₁₄N₂O₂

Color and Shape: Solid

Molecular weight: 278.3053

Ref: IN-DA004QVO