CAS 863548-41-8

3-(Methoxymethyl)-2-pyridinemethanamine

Description:

3-(Methoxymethyl)-2-pyridinemethanamine, with the CAS number 863548-41-8, is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a methoxymethyl group, which is a methoxy (-OCH3) group attached to a methylene (-CH2-) bridge, enhancing its solubility and reactivity. The presence of the amine functional group (-NH2) contributes to its basicity and potential for forming hydrogen bonds, making it a candidate for various chemical reactions, including nucleophilic substitutions. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of drugs targeting neurological or psychiatric conditions, due to the pyridine moiety's known biological activity. Additionally, the compound's properties, such as melting point, boiling point, and solubility, would be influenced by the presence of the methoxy and amine groups, which can affect its interactions with other substances. Overall, 3-(Methoxymethyl)-2-pyridinemethanamine is a versatile compound with potential implications in medicinal chemistry.

Formula: C₈H₁₂N₂O

InChI: InChI=1S/C8H12N2O/c1-11-6-7-3-2-4-10-8(7)5-9/h2-4H,5-6,9H2,1H3

InChI key: InChIKey=QWPBXDOUZMQLHG-UHFFFAOYSA-N

SMILES: C(OC)C1=C(CN)N=CC=C1

Synonyms:

• 2-Pyridinemethanamine, 3-(methoxymethyl)-
• 3-Methoxymethylpyridine-2-methanamine
• 3-(Methoxymethyl)-2-pyridinemethanamine
• [3-(Methoxymethyl)pyridin-2-yl]methanamine