CymitQuimica logo

CAS 86356-70-9

:

boron 3,3'-dichlorobiphenyl-4,4'-bis(diazonium) fluoride (2:1:8)

Description:
Boron 3,3'-dichlorobiphenyl-4,4'-bis(diazonium) fluoride (2:1:8), with the CAS number 86356-70-9, is a specialized chemical compound that features a biphenyl structure substituted with chlorine and diazonium groups. This compound is characterized by its unique reactivity due to the presence of diazonium functional groups, which are known for their ability to participate in electrophilic aromatic substitution reactions. The incorporation of boron into the structure may enhance its electronic properties and stability. The fluoride component suggests potential applications in materials science, particularly in the development of advanced polymers or as a precursor in organic synthesis. The compound's specific characteristics, such as solubility, stability, and reactivity, can vary based on environmental conditions and the presence of other reagents. Safety precautions should be observed when handling this compound, as diazonium salts can be sensitive to heat and light, potentially leading to decomposition or hazardous reactions. Overall, this compound represents a niche area of study within organic and materials chemistry.
Formula:C12H6B2Cl2F8N4
InChI:InChI=1/C12H6Cl2N4.2B.8FH/c13-9-5-7(1-3-11(9)17-15)8-2-4-12(18-16)10(14)6-8;;;;;;;;;;/h1-6H;;;8*1H/q+2;2*+3;;;;;;;;/p-8
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.