CymitQuimica logo

CAS 86357-20-2

:

2-[(2-amino-6-oxo-3,6-dihydro-9H-purin-9-yl)methoxy]propane-1,3-diyl dipropanoate

Description:
The chemical substance known as 2-[(2-amino-6-oxo-3,6-dihydro-9H-purin-9-yl)methoxy]propane-1,3-diyl dipropanoate, with the CAS number 86357-20-2, is a synthetic compound that features a purine derivative structure. This compound is characterized by the presence of a purine ring, which is a fundamental component of nucleic acids, and it includes functional groups such as methoxy and dipropanoate moieties. The presence of the amino and keto groups contributes to its potential biological activity, possibly influencing its interaction with biological systems. The dipropanoate groups suggest that the compound may have ester functionalities, which can affect its solubility and reactivity. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting nucleic acid-related processes. Its specific properties, such as solubility, stability, and biological activity, would depend on the molecular interactions and the environment in which it is studied.
Formula:C15H21N5O6
InChI:InChI=1/C15H21N5O6/c1-3-10(21)24-5-9(6-25-11(22)4-2)26-8-20-7-17-12-13(20)18-15(16)19-14(12)23/h7,9H,3-6,8H2,1-2H3,(H3,16,18,19,23)
SMILES:CCC(=O)OCC(COC(=O)CC)OCn1cnc2c1[nH]c(=N)nc2O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 5 products.