CAS 863668-02-4

5,7-Dimethyl-2-(methylthio)[1,2,4]triazolo[1,5-a]pyrimidine-6-acetic acid

Description:

5,7-Dimethyl-2-(methylthio)[1,2,4]triazolo[1,5-a]pyrimidine-6-acetic acid is a chemical compound characterized by its unique triazole and pyrimidine ring structure, which contributes to its biological activity. This compound features two methyl groups at the 5 and 7 positions, enhancing its lipophilicity and potentially influencing its interaction with biological targets. The presence of a methylthio group at the 2-position adds to its chemical diversity and may affect its solubility and reactivity. The acetic acid functional group at the 6-position introduces acidity, which can play a role in its pharmacological properties. This compound is of interest in medicinal chemistry, particularly for its potential applications in drug development, possibly exhibiting anti-inflammatory or anti-cancer activities. Its specific interactions and mechanisms of action would require further investigation through experimental studies. As with many synthetic compounds, understanding its stability, solubility, and reactivity under various conditions is crucial for its application in research and industry.

Formula: C₁₀H₁₂N₄O₂S

InChI: InChI=1S/C10H12N4O2S/c1-5-7(4-8(15)16)6(2)14-9(11-5)12-10(13-14)17-3/h4H2,1-3H3,(H,15,16)

InChI key: InChIKey=AFWKTHVGDRIPLU-UHFFFAOYSA-N

SMILES: CC=1N2C(=NC(SC)=N2)N=C(C)C1CC(O)=O

Synonyms:

• 5,7-Dimethyl-2-(methylthio)[1,2,4]triazolo[1,5-a]pyrimidine-6-acetic acid
• [5,7-Dimethyl-2-(methylthio)[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]acetic acid
• 2-[5,7-Dimethyl-2-(methylsulfanyl)-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]acetic acid
• [1,2,4]Triazolo[1,5-a]pyrimidine-6-acetic acid, 5,7-dimethyl-2-(methylthio)-

2-[5,7-Dimethyl-2-(methylsulfanyl)-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]acetic acid

CAS: 863668-02-4

Versatile small molecule scaffold

Formula: C₁₀H₁₂N₄O₂S

Purity: Min. 95%

Molecular weight: 252.3 g/mol

Ref: 3D-NJB66802