CymitQuimica logo

CAS 863669-05-0

:

3-Chloro-4-(diethylamino)-1-(4-fluorophenyl)-1H-pyrrole-2,5-dione

Description:
3-Chloro-4-(diethylamino)-1-(4-fluorophenyl)-1H-pyrrole-2,5-dione, with CAS number 863669-05-0, is a synthetic organic compound characterized by its complex molecular structure, which includes a pyrrole ring substituted with various functional groups. This compound features a chloro group and a diethylamino moiety, contributing to its potential biological activity. The presence of a fluorophenyl group enhances its lipophilicity and may influence its interaction with biological targets. Typically, compounds of this nature are investigated for their pharmacological properties, including potential applications in medicinal chemistry. The pyrrole-2,5-dione core is known for its reactivity and ability to participate in various chemical reactions, making it a valuable scaffold in drug design. Additionally, the compound's solubility, stability, and reactivity can be influenced by the substituents on the pyrrole ring, which are critical for determining its behavior in biological systems and its suitability for further development in therapeutic applications.
Formula:C14H14ClFN2O2
InChI:InChI=1S/C14H14ClFN2O2/c1-3-17(4-2)12-11(15)13(19)18(14(12)20)10-7-5-9(16)6-8-10/h5-8H,3-4H2,1-2H3
InChI key:InChIKey=RRVHAZDAZGVOME-UHFFFAOYSA-N
SMILES:O=C1N(C(=O)C(Cl)=C1N(CC)CC)C2=CC=C(F)C=C2
Synonyms:
  • 3-Chloro-4-(diethylamino)-1-(4-fluorophenyl)-1H-pyrrole-2,5-dione
  • 1H-Pyrrole-2,5-dione, 3-chloro-4-(diethylamino)-1-(4-fluorophenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.