CAS 863669-60-7

[4-(2-Methylpropyl)phenyl]-2-thienylmethanone

Description:

[4-(2-Methylpropyl)phenyl]-2-thienylmethanone, with the CAS number 863669-60-7, is an organic compound characterized by its unique structure that includes a thienyl group and a substituted phenyl group. This compound typically exhibits properties associated with ketones, such as being a solid or liquid at room temperature, depending on its specific formulation and purity. It may possess a moderate to high melting point and a relatively low volatility, which is common for compounds with larger molecular weights. The presence of the thienyl group can impart distinct electronic and steric properties, potentially influencing its reactivity and interactions with other substances. Additionally, due to the presence of the isopropyl substituent, the compound may exhibit hydrophobic characteristics, affecting its solubility in various solvents. Its applications could range from use in organic synthesis to potential roles in pharmaceuticals or materials science, depending on its specific reactivity and functional properties. However, detailed safety and handling information should be consulted for practical applications.

Formula: C₁₅H₁₆OS

InChI: InChI=1S/C15H16OS/c1-11(2)10-12-5-7-13(8-6-12)15(16)14-4-3-9-17-14/h3-9,11H,10H2,1-2H3

InChI key: InChIKey=BWWFWPJFTJDYID-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC=C(CC(C)C)C=C1)C2=CC=CS2

Synonyms:

• [4-(2-Methylpropyl)phenyl]-2-thienylmethanone
• Methanone, [4-(2-methylpropyl)phenyl]-2-thienyl-