CAS 86377-52-8
:Ganoderic acid Y
Description:
Ganoderic acid Y is a triterpenoid compound primarily derived from the Ganoderma lucidum mushroom, commonly known as reishi or lingzhi. This compound is part of a larger class of ganoderic acids, which are known for their diverse biological activities. Ganoderic acid Y exhibits various pharmacological properties, including anti-inflammatory, antioxidant, and potential anticancer effects. Its structure features a complex arrangement of carbon rings and functional groups, contributing to its bioactivity. The compound has garnered interest in traditional medicine and modern pharmacology due to its potential health benefits. Additionally, research indicates that ganoderic acids may influence immune system modulation and exhibit hepatoprotective properties. While studies are ongoing to fully elucidate its mechanisms of action and therapeutic potential, Ganoderic acid Y represents a significant area of interest in natural product chemistry and medicinal research. As with many bioactive compounds, further investigation is necessary to determine its efficacy and safety in clinical applications.
Formula:C30H46O3
InChI:InChI=1S/C30H46O3/c1-19(9-8-10-20(2)26(32)33)21-13-17-30(7)23-11-12-24-27(3,4)25(31)15-16-28(24,5)22(23)14-18-29(21,30)6/h10-11,14,19,21,24-25,31H,8-9,12-13,15-18H2,1-7H3,(H,32,33)/b20-10+/t19-,21-,24+,25+,28-,29-,30+/m1/s1
InChI key:InChIKey=HUTCYUJPLOTDMX-SPPZYOJVSA-N
SMILES:C[C@]12C=3C([C@]4(C)[C@@](CC3)(C(C)(C)[C@@H](O)CC4)[H])=CC[C@]1(C)[C@@]([C@@H](CC/C=C(/C(O)=O)\C)C)(CC2)[H]
Synonyms:- (3β,24E)-3-Hydroxylanosta-7,9(11),24-trien-26-oic acid
- Ganoderic acid Y
- Ganodericacid Y
- Lanosta-7,9(11),24-trien-26-oic acid, 3-hydroxy-, (3β,24E)-
- (3beta,24E)-3-Hydroxylanosta-7,9(11),24-trien-26-oic acid
- Lanosta-7,9(11),24-trien-26-oicacid, 3-hydroxy-, (3b,24E)-
- (24E)-3β-Hydroxy-5α-lanosta-7,9(11),24-trien-26-oic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Ganoderic acid Y
CAS:Ganoderic acid Y significantly inhibits the replication of the viral RNA (vRNA) of EV71 replication through blocking EV71 uncoating.Formula:C30H46O3Purity:98%Color and Shape:SolidMolecular weight:454.68Ganoderic acid Y
CAS:Controlled Product<p>Ganoderic acid Y is a natural compound that is found in the mushroom Ganoderma lucidum. It is a mutant of the enzyme glutamine synthetase and has been shown to alter transcriptional regulation. This compound binds to the nitrogen of guanine nucleotides, which inhibits synthesis of RNA and DNA. Ganoderic acid Y also has been shown to inhibit energy metabolism by inhibiting enzymes that are involved in the synthesis of ATP and NADH and may have anti-inflammatory properties due to its ability to inhibit the production of prostaglandins.</p>Formula:C30H46O3Purity:Min. 95%Molecular weight:454.7 g/mol
