CAS 86377-53-9
:(3α,15α,24E)-15-(Acetyloxy)-3-hydroxylanosta-7,9(11),24-trien-26-oic acid
Description:
The chemical substance known as "(3α,15α,24E)-15-(Acetyloxy)-3-hydroxylanosta-7,9(11),24-trien-26-oic acid," with the CAS number 86377-53-9, is a steroid derivative characterized by its complex structure, which includes multiple functional groups such as hydroxyl and acetoxy moieties. This compound features a lanostane backbone, which is typical of many natural steroids, and exhibits a triene system, indicating the presence of three conjugated double bonds. The presence of the acetoxy group suggests potential reactivity and biological activity, as acetylation can influence the solubility and interaction of the molecule with biological targets. The hydroxyl group contributes to its polarity and potential for hydrogen bonding, which may enhance its solubility in polar solvents. Such compounds are often studied for their pharmacological properties, including anti-inflammatory and anticancer activities, due to their structural similarity to naturally occurring steroids. Overall, this compound's unique structural features make it a subject of interest in medicinal chemistry and natural product research.
Formula:C32H48O5
InChI:InChI=1S/C32H48O5/c1-19(10-9-11-20(2)28(35)36)24-18-27(37-21(3)33)32(8)23-12-13-25-29(4,5)26(34)15-16-30(25,6)22(23)14-17-31(24,32)7/h11-12,14,19,24-27,34H,9-10,13,15-18H2,1-8H3,(H,35,36)/b20-11+/t19-,24-,25+,26-,27+,30-,31-,32-/m1/s1
InChI key:InChIKey=YCWGPALSXRBKTM-XGNRZNIMSA-N
SMILES:C[C@]12C=3C([C@]4(C)[C@@](CC3)(C(C)(C)[C@H](O)CC4)[H])=CC[C@]1(C)[C@@]([C@@H](CC/C=C(/C(O)=O)\C)C)(C[C@@H]2OC(C)=O)[H]
Synonyms:- Ganoderic acid X
- (3α,15α,24E)-15-(Acetyloxy)-3-hydroxylanosta-7,9(11),24-trien-26-oic acid
- Lanosta-7,9(11),24-trien-26-oic acid, 15-(acetyloxy)-3-hydroxy-, (3α,15α,24E)-
- (24E)-15α-Acetyloxy-3α-hydroxy-5α-lanosta-7,9(11),24-trien-26-oic acid
- (24E)-3α-Hydroxy-15α-acetoxylanosta-7,9(11),24-triene-26-oic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Ganoderic acid X
CAS:Ganoderic acid X is a potential Mdm2 inhibitor(K(i) = 16nM). It is a potential anticancer drug, inhibits topoisomerases and induces apoptosis of cancer cells.
Formula:C32H48O5Purity:98%Color and Shape:SolidMolecular weight:512.731Ganoderic acid X
CAS:Ganoderic acid X is a bioactive triterpenoid, which is a compound extracted from the medicinal mushroom Ganoderma lucidum, commonly known as Reishi. This mushroom is renowned in traditional medicine for its diverse therapeutic properties. The source, Ganoderma lucidum, is a basidiomycete fungus known for its potent metabolic pathways that produce a variety of bioactive compounds, including triterpenoids, polysaccharides, and peptides.
Formula:C32H48O5Purity:Min. 95%Molecular weight:512.70 g/mol

