
CAS 86384-98-7
:1,4-Dihydro-2,6-dimethyl-4-(3-nitrophenyl)-3,5-pyridinedicarboxylic acid methyl 6-(5-phenyl-3-pyrazolyloxy)hexyl ester
Description:
1,4-Dihydro-2,6-dimethyl-4-(3-nitrophenyl)-3,5-pyridinedicarboxylic acid methyl 6-(5-phenyl-3-pyrazolyloxy)hexyl ester, with CAS number 86384-98-7, is a complex organic compound characterized by its multi-functional structure. It features a pyridine ring, which is a six-membered aromatic ring containing nitrogen, contributing to its potential biological activity. The presence of multiple functional groups, including carboxylic acid and ester moieties, suggests that it may exhibit diverse chemical reactivity and solubility properties. The nitrophenyl group indicates potential for electronic interactions, while the pyrazole moiety may impart specific pharmacological properties. This compound is likely to be of interest in medicinal chemistry, particularly for its potential applications in drug development or as a biochemical probe. Its synthesis and characterization would involve standard organic chemistry techniques, and its stability, solubility, and reactivity would be influenced by the steric and electronic effects of the substituents on the core structure. Further studies would be necessary to elucidate its biological activity and potential therapeutic applications.
Formula:C31H34N4O7
InChI:InChI=1/C31H34N4O7/c1-20-27(30(36)40-3)29(23-14-11-15-24(18-23)35(38)39)28(21(2)32-20)31(37)42-17-10-5-4-9-16-41-26-19-25(33-34-26)22-12-7-6-8-13-22/h6-8,11-15,18-19,29,32H,4-5,9-10,16-17H2,1-3H3,(H,33,34)
SMILES:CC1=C(C(c2cccc(c2)N(=O)=O)C(=C(C)N1)C(=O)OCCCCCCOc1cc(c2ccccc2)[nH]n1)C(=O)OC
Synonyms:- Cv-159
- 1,4-Dihydro-2,6-dimethyl-4-(3-nitrophenyl)-3-methoxycarbonylpyridine-5-carboxylic acid 6-(5-phenyl-3-pyrazolyloxy)hexyl ester
- methyl 6-[(5-phenyl-1H-pyrazol-3-yl)oxy]hexyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
1,4-Dihydro-2,6-dimethyl-4-(3--nitrophenyl)-3,5-pyridinedicarboxylic acid methyl-6-(5-phenyl-3-pyrazolyloxy)hexyl ester
CAS:<p>1,4-Dihydro-2,6-dimethyl-4-(3--nitrophenyl)-3,5-pyridinedicarboxylic acid methyl-6-(5-phenyl-3-pyrazolyloxy)hexyl ester is a research tool that is used in the study of cell biology. It is an activator ligand for various receptors and ion channels. The chemical has been shown to inhibit the activity of protein interactions. The 1,4-dihydro--2,6-dimethyl--4-(3--nitrophenyl)-3,5--pyridinedicarboxylic acid methyl--6-(5-phenyl--3-pyrazolyloxy)hexyl ester is a high purity product that can be used as a reagent or chemical intermediate in the production of peptides and other life science products. The CAS number for this chemical compound is 86384</p>Formula:C31H34N4O7Purity:Min. 95%Molecular weight:574.6 g/molCV-159
CAS:CV-159 is a unique dihydropyridine Ca2+ antagonist with antiinflammatory activities. It has an anti-calmodulin (CaM) action.Formula:C31H34N4O7Purity:98%Color and Shape:SolidMolecular weight:574.62

