CymitQuimica logo

CAS 863868-54-6

:

5-Bromo-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinecarbonitrile

Description:
5-Bromo-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinecarbonitrile is a chemical compound characterized by its complex structure, which includes a bromine atom, a pyridine ring, and a dioxaborolane moiety. The presence of the bromine substituent enhances its reactivity, making it useful in various synthetic applications, particularly in organic synthesis and medicinal chemistry. The dioxaborolane group contributes to its potential as a boron-containing compound, which can participate in cross-coupling reactions, a key process in the formation of carbon-carbon bonds. The nitrile functional group (-C≡N) adds to its polarity and can influence its solubility and reactivity. This compound is typically used in research settings, particularly in the development of pharmaceuticals and agrochemicals. Its unique combination of functional groups allows for diverse applications, including potential roles in catalysis and material science. Safety and handling precautions should be observed due to the presence of bromine and other reactive functionalities.
Formula:C12H14BBrN2O2
InChI:InChI=1S/C12H14BBrN2O2/c1-11(2)12(3,4)18-13(17-11)9-5-8(6-15)16-7-10(9)14/h5,7H,1-4H3
InChI key:InChIKey=QYYMMIXHBYTYFZ-UHFFFAOYSA-N
SMILES:BrC1=C(C=C(C#N)N=C1)B2OC(C)(C)C(C)(C)O2
Synonyms:
  • 2-Pyridinecarbonitrile, 5-bromo-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
  • 5-Bromo-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinecarbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.