CymitQuimica logo

CAS 863870-93-3

:

4-Bromo-2-butylbenzofuran

Description:
4-Bromo-2-butylbenzofuran is an organic compound characterized by its unique structure, which includes a benzofuran moiety substituted with a bromine atom and a butyl group. The presence of the bromine atom introduces notable reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. The butyl group contributes to the hydrophobic character of the molecule, influencing its solubility and interaction with biological systems. This compound may exhibit interesting pharmacological properties due to its structural features, which can affect its binding affinity to biological targets. Additionally, the benzofuran core is known for its presence in various natural products and synthetic compounds, often associated with diverse biological activities. The compound's physical properties, such as melting point, boiling point, and solubility, would depend on its molecular interactions and the presence of functional groups. Overall, 4-Bromo-2-butylbenzofuran represents a class of compounds that can be explored for their synthetic utility and potential applications in medicinal chemistry.
Formula:C12H13BrO
InChI:InChI=1S/C12H13BrO/c1-2-3-5-9-8-10-11(13)6-4-7-12(10)14-9/h4,6-8H,2-3,5H2,1H3
InChI key:InChIKey=NFMKCHFGGZZPHL-UHFFFAOYSA-N
SMILES:BrC1=C2C(OC(CCCC)=C2)=CC=C1
Synonyms:
  • Benzofuran, 4-bromo-2-butyl-
  • 4-Bromo-2-butylbenzofuran
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.