CymitQuimica logo

CAS 863971-44-2

:

(5S,8S,11S,12R)-11-((S)-sec-butyl)-1-(9H-fluoren-9-yl)-5,8-diisopropyl-12-methoxy-4,10-dimethyl-3,6,9-trioxo-2-oxa-4,7,10-triazatetradecan-14-oic acid

Description:
The chemical substance with the name "(5S,8S,11S,12R)-11-((S)-sec-butyl)-1-(9H-fluoren-9-yl)-5,8-diisopropyl-12-methoxy-4,10-dimethyl-3,6,9-trioxo-2-oxa-4,7,10-triazatetradecan-14-oic acid" and CAS number "863971-44-2" is a complex organic compound characterized by its intricate structure, which includes multiple functional groups and stereocenters. This compound features a triazatetradecan backbone, indicating the presence of nitrogen atoms within a long carbon chain, which contributes to its potential biological activity. The presence of isopropyl and sec-butyl groups suggests hydrophobic characteristics, while the methoxy and fluorenyl moieties may enhance solubility and stability. The trioxo functional groups indicate potential reactivity, possibly allowing for interactions with biological targets. Its stereochemistry, denoted by the specific configuration at various chiral centers, is crucial for its biological activity and pharmacological properties. Overall, this compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its unique structural features and potential bioactivity.
Formula:C36H51N3O7
InChI:InChI=1S/C36H51N3O7/c1-10-23(6)33(29(45-9)19-30(40)41)38(7)35(43)31(21(2)3)37-34(42)32(22(4)5)39(8)36(44)46-20-28-26-17-13-11-15-24(26)25-16-12-14-18-27(25)28/h11-18,21-23,28-29,31-33H,10,19-20H2,1-9H3,(H,37,42)(H,40,41)/t23-,29+,31-,32-,33-/m0/s1
InChI key:SMVBIYSFDNRJJI-FCUBIXSHSA-N
SMILES:CC[C@H](C)[C@@H]([C@@H](CC(=O)O)OC)N(C)C(=O)[C@H](C(C)C)NC(=O)[C@H](C(C)C)N(C)C(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13
Found 7 products.