CymitQuimica logo

CAS 863975-37-5

:

diethyl (cyclopropylmethyl)phosphonate

Description:
Diethyl (cyclopropylmethyl)phosphonate is an organophosphorus compound characterized by the presence of a phosphonate functional group, which features a phosphorus atom bonded to an oxygen atom and two ethyl groups. The compound also contains a cyclopropylmethyl group, contributing to its unique structural properties. Typically, organophosphonates exhibit moderate to high polarity due to the presence of the phosphorus-oxygen bond, which can influence their solubility in various solvents. This compound may be of interest in fields such as agrochemicals, pharmaceuticals, or materials science due to its potential biological activity and reactivity. Its molecular structure allows for various interactions, making it a candidate for further research in synthetic applications or as a precursor in chemical synthesis. Safety and handling precautions are essential, as organophosphorus compounds can exhibit toxicity, particularly in relation to their effects on the nervous system. As with any chemical, proper characterization through techniques such as NMR, IR spectroscopy, and mass spectrometry is crucial for understanding its properties and potential applications.
Formula:C8H17O3P
InChI:InChI=1/C8H17O3P/c1-3-10-12(9,11-4-2)7-8-5-6-8/h8H,3-7H2,1-2H3
SMILES:CCOP(=O)(CC1CC1)OCC
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.