CymitQuimica logo

CAS 863983-46-4

:

N-(3-aminopropyl)-2-nitro-benzenesulfonamide hydrochloride

Description:
N-(3-aminopropyl)-2-nitro-benzenesulfonamide hydrochloride is a chemical compound characterized by its sulfonamide structure, which includes a nitro group and an aminoalkyl side chain. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form. The sulfonamide moiety contributes to its potential biological activity, often associated with antibacterial properties. The nitro group may also impart additional reactivity, making it useful in various chemical syntheses or as a pharmacological agent. Its molecular structure allows for interactions with biological targets, which can be significant in medicinal chemistry. As with many sulfonamides, it may exhibit a range of pharmacological effects, and its safety profile should be evaluated in the context of its intended use. Proper handling and storage conditions are essential to maintain its stability and efficacy, as with many chemical substances.
Formula:C9H14ClN3O4S
InChI:InChI=1/C9H13N3O4S.ClH/c10-6-3-7-11-17(15,16)9-5-2-1-4-8(9)12(13)14;/h1-2,4-5,11H,3,6-7,10H2;1H
InChI key:UADJAJMVAIAKHQ-UHFFFAOYSA-N
SMILES:c1ccc(c(c1)N(=O)=O)S(=O)(=O)NCCCN.Cl
Found 3 products.