CymitQuimica logo

CAS 864068-81-5

:

2-(Imidazo[1,2-a]pyridin-6-ylmethyl)-1H-isoindole-1,3(2H)-dione

Description:
2-(Imidazo[1,2-a]pyridin-6-ylmethyl)-1H-isoindole-1,3(2H)-dione, with the CAS number 864068-81-5, is a chemical compound characterized by its complex structure, which includes an isoindole moiety and an imidazopyridine group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in medicinal chemistry. The presence of both the isoindole and imidazopyridine rings suggests that it may interact with biological targets, possibly influencing various signaling pathways. Its molecular structure may confer specific pharmacological properties, which could be explored in drug development. Additionally, the compound's stability, reactivity, and potential for forming derivatives are important characteristics that can affect its application in research and industry. As with many heterocyclic compounds, it may also exhibit unique electronic properties due to the presence of nitrogen atoms in its rings, influencing its behavior in chemical reactions and interactions with other molecules.
Formula:C16H11N3O2
InChI:InChI=1S/C16H11N3O2/c20-15-12-3-1-2-4-13(12)16(21)19(15)10-11-5-6-14-17-7-8-18(14)9-11/h1-9H,10H2
InChI key:InChIKey=ZBACLVPTQBTADW-UHFFFAOYSA-N
SMILES:O=C1C=2C(C(=O)N1CC3=CN4C(C=C3)=NC=C4)=CC=CC2
Synonyms:
  • 1H-Isoindole-1,3(2H)-dione, 2-(imidazo[1,2-a]pyridin-6-ylmethyl)-
  • 2-(Imidazo[1,2-a]pyridin-6-ylmethyl)-1H-isoindole-1,3(2H)-dione
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.