CAS 864068-93-9

1-(4-iodobenzyl)-1H-1,2,4-triazole

Description:

1-(4-Iodobenzyl)-1H-1,2,4-triazole is a chemical compound characterized by its triazole ring, which is a five-membered heterocyclic structure containing three nitrogen atoms. The presence of the 4-iodobenzyl group enhances its reactivity and solubility in organic solvents. This compound typically exhibits properties such as moderate to high stability under standard conditions, and it may show biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure allows for potential interactions with biological targets, which can be explored for therapeutic applications. Additionally, the iodine substituent can facilitate various chemical reactions, including nucleophilic substitutions and coupling reactions. The compound's solubility, melting point, and other physical properties can vary based on the solvent and conditions used. Overall, 1-(4-iodobenzyl)-1H-1,2,4-triazole represents a versatile scaffold in organic synthesis and pharmaceutical research.

Formula: C₉H₈IN₃

InChI: InChI=1/C9H8IN3/c10-9-3-1-8(2-4-9)5-13-7-11-6-12-13/h1-4,6-7H,5H2

SMILES: c1cc(ccc1Cn1cncn1)I

Synonyms:

• 1H-1,2,4-Triazole, 1-[(4-iodophenyl)methyl]-
• 1-(4-IODOBENZYL)-1H-1,2,4-TRIAZOLE

1-(4-Iodobenzyl)-1H-1,2,4-triazole

CAS: 864068-93-9

1-(4-Iodobenzyl)-1H-1,2,4-triazole

Purity: ≥95%

Molecular weight: 285.08g/mol

Ref: 54-OR111610