CAS 864068-99-5

1-[2-(3-chlorophenyl)-1,3-thiazol-4-yl]-N-methylmethanamine

Description:

1-[2-(3-chlorophenyl)-1,3-thiazol-4-yl]-N-methylmethanamine, with the CAS number 864068-99-5, is a chemical compound characterized by its thiazole and amine functional groups. This substance features a thiazole ring, which is a five-membered heterocyclic compound containing both sulfur and nitrogen, contributing to its biological activity. The presence of the 3-chlorophenyl group enhances its lipophilicity and may influence its interaction with biological targets. As a tertiary amine, the N-methyl group can affect the compound's solubility and reactivity. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of therapeutic agents. Its specific characteristics, such as melting point, solubility, and spectral data, would typically be determined through experimental methods. Safety and handling information would also be essential for laboratory work involving this compound, as with any chemical substance. Overall, its unique structure suggests potential applications in various fields, including pharmaceuticals and agrochemicals.

Formula: C₁₁H₁₁ClN₂S

InChI: InChI=1/C11H11ClN2S/c1-13-6-10-7-15-11(14-10)8-3-2-4-9(12)5-8/h2-5,7,13H,6H2,1H3

SMILES: CNCc1csc(c2cccc(c2)Cl)n1

2-(3-Chlorophenyl)-4-[(methylamino)methyl]-1,3-thiazole

CAS: 864068-99-5

2-(3-Chlorophenyl)-4-[(methylamino)methyl]-1,3-thiazole

Purity: 90%

Color and Shape: Brown Liquid

Molecular weight: 238.74g/mol

Ref: 54-OR2067